C16H24O4 — CID 11460175
(3E,7E,9S,10S,11R,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one (PubChem CID 11460175) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (3E,7E,9S,10S,11R,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one.
| Compound Name | (3E,7E,9S,10S,11R,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one |
|---|---|
| PubChem CID | 11460175 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (3E,7E,9S,10S,11R,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one |
| SMILES | CO[C@H]1/C=C/CC/C=C/C(=O)OC/C(C)=C\[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C16H24O4/c1-12-10-13(2)16(18)14(19-3)8-6-4-5-7-9-15(17)20-11-12/h6-10,13-14,16,18H,4-5,11H2,1-3H3/b8-6+,9-7+,12-10-/t13-,14+,16+/m1/s1 |
| InChIKey | PJYFJICDSHGWTI-IDMBQERYSA-N |
| XLogP | 2.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|