C21H32O3 — CID 163020516
[(4R,6R,7E,9Z)-6-methoxy-2,6,10-trimethyldodeca-2,7,9,11-tetraen-4-yl] (Z)-2-methylbut-2-enoate (PubChem CID 163020516) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is [(4R,6R,7E,9Z)-6-methoxy-2,6,10-trimethyldodeca-2,7,9,11-tetraen-4-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(4R,6R,7E,9Z)-6-methoxy-2,6,10-trimethyldodeca-2,7,9,11-tetraen-4-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163020516 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | [(4R,6R,7E,9Z)-6-methoxy-2,6,10-trimethyldodeca-2,7,9,11-tetraen-4-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C/C(C)=C\C=C\[C@@](C)(C[C@H](C=C(C)C)OC(=O)/C(C)=C\C)OC |
| InChI | InChI=1S/C21H32O3/c1-9-17(5)12-11-13-21(7,23-8)15-19(14-16(3)4)24-20(22)18(6)10-2/h9-14,19H,1,15H2,2-8H3/b13-11+,17-12-,18-10-/t19-,21-/m0/s1 |
| InChIKey | HMWSUTVUCYCWMI-VGALWWKASA-N |
| XLogP | 5.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|