C20H30O3 — CID 162972710
(6-hydroxy-2,6,10-trimethyldodeca-2,7,9,11-tetraen-4-yl) 2-methylbut-2-enoate (PubChem CID 162972710) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (6-hydroxy-2,6,10-trimethyldodeca-2,7,9,11-tetraen-4-yl) 2-methylbut-2-enoate.
| Compound Name | (6-hydroxy-2,6,10-trimethyldodeca-2,7,9,11-tetraen-4-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162972710 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (6-hydroxy-2,6,10-trimethyldodeca-2,7,9,11-tetraen-4-yl) 2-methylbut-2-enoate |
| SMILES | C=CC(C)=CC=CC(C)(O)CC(C=C(C)C)OC(=O)C(C)=CC |
| InChI | InChI=1S/C20H30O3/c1-8-16(5)11-10-12-20(7,22)14-18(13-15(3)4)23-19(21)17(6)9-2/h8-13,18,22H,1,14H2,2-7H3 |
| InChIKey | DVOGANCJBAEQAP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|