C20H35IO4Si — CID 59202260
methyl (5S,6S,7E,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-2-methoxy-6,8-dimethyldeca-2,7,9-trienoate (PubChem CID 59202260) has the molecular formula C20H35IO4Si and a molecular weight of 494.49 g/mol. Its IUPAC name is methyl (5S,6S,7E,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-2-methoxy-6,8-dimethyldeca-2,7,9-trienoate.
| Compound Name | methyl (5S,6S,7E,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-2-methoxy-6,8-dimethyldeca-2,7,9-trienoate |
|---|---|
| PubChem CID | 59202260 |
| Molecular Formula | C20H35IO4Si |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | methyl (5S,6S,7E,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-2-methoxy-6,8-dimethyldeca-2,7,9-trienoate |
| SMILES | COC(=O)C(=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C(C)/C=C\I)OC |
| InChI | InChI=1S/C20H35IO4Si/c1-15(12-13-21)14-16(2)17(25-26(8,9)20(3,4)5)10-11-18(23-6)19(22)24-7/h11-14,16-17H,10H2,1-9H3/b13-12-,15-14+,18-11?/t16-,17-/m0/s1 |
| InChIKey | BHLKVWUBOANZKJ-BLZPFGTDSA-N |
| XLogP | 6.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|