C19H33IO3Si — CID 71681419
methyl (2E,4S,5R,6E,8Z)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-4,6,8-trimethylnona-2,6,8-trienoate (PubChem CID 71681419) has the molecular formula C19H33IO3Si and a molecular weight of 464.46 g/mol. Its IUPAC name is methyl (2E,4S,5R,6E,8Z)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-4,6,8-trimethylnona-2,6,8-trienoate.
| Compound Name | methyl (2E,4S,5R,6E,8Z)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-4,6,8-trimethylnona-2,6,8-trienoate |
|---|---|
| PubChem CID | 71681419 |
| Molecular Formula | C19H33IO3Si |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | methyl (2E,4S,5R,6E,8Z)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-4,6,8-trimethylnona-2,6,8-trienoate |
| SMILES | COC(=O)/C=C/[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/C(C)=C\I |
| InChI | InChI=1S/C19H33IO3Si/c1-14(13-20)12-16(3)18(15(2)10-11-17(21)22-7)23-24(8,9)19(4,5)6/h10-13,15,18H,1-9H3/b11-10+,14-13-,16-12+/t15-,18+/m0/s1 |
| InChIKey | WHMRJDZSRPKRKF-NUMSMUMTSA-N |
| XLogP | 6.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|