C20H26O6 — CID 162870635
methyl 2-[2-[2-(3,7-dimethylocta-2,6-dienoxy)-2-oxoethyl]-6-oxopyran-3-yl]acetate (PubChem CID 162870635) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is methyl 2-[2-[2-(3,7-dimethylocta-2,6-dienoxy)-2-oxoethyl]-6-oxopyran-3-yl]acetate.
| Compound Name | methyl 2-[2-[2-(3,7-dimethylocta-2,6-dienoxy)-2-oxoethyl]-6-oxopyran-3-yl]acetate |
|---|---|
| PubChem CID | 162870635 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | methyl 2-[2-[2-(3,7-dimethylocta-2,6-dienoxy)-2-oxoethyl]-6-oxopyran-3-yl]acetate |
| SMILES | COC(=O)Cc1ccc(=O)oc1CC(=O)OCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C20H26O6/c1-14(2)6-5-7-15(3)10-11-25-20(23)13-17-16(12-19(22)24-4)8-9-18(21)26-17/h6,8-10H,5,7,11-13H2,1-4H3 |
| InChIKey | BIQNCHSICZSXCV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|