C27H37N3O6 — CID 143964238
methyl (2S,4S)-4-methoxy-1-[2-[6-(3-methoxynaphthalen-2-yl)hexylcarbamoylamino]acetyl]pyrrolidine-2-carboxylate (PubChem CID 143964238) has the molecular formula C27H37N3O6 and a molecular weight of 499.61 g/mol. Its IUPAC name is methyl (2S,4S)-4-methoxy-1-[2-[6-(3-methoxynaphthalen-2-yl)hexylcarbamoylamino]acetyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-4-methoxy-1-[2-[6-(3-methoxynaphthalen-2-yl)hexylcarbamoylamino]acetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 143964238 |
| Molecular Formula | C27H37N3O6 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | methyl (2S,4S)-4-methoxy-1-[2-[6-(3-methoxynaphthalen-2-yl)hexylcarbamoylamino]acetyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OC)CN1C(=O)CNC(=O)NCCCCCCc1cc2ccccc2cc1OC |
| InChI | InChI=1S/C27H37N3O6/c1-34-22-16-23(26(32)36-3)30(18-22)25(31)17-29-27(33)28-13-9-5-4-6-12-21-14-19-10-7-8-11-20(19)15-24(21)35-2/h7-8,10-11,14-15,22-23H,4-6,9,12-13,16-18H2,1-3H3,(H2,28,29,33)/t22-,23-/m0/s1 |
| InChIKey | KFHPHJURAFQMJS-GOTSBHOMSA-N |
| XLogP | 3.04 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|