C32H36N4O8 — CID 145379374
methyl (4R)-4-[3-(3-ethenylphenyl)-6,7-dimethoxyquinoxalin-2-yl]oxy-1-[2-(pent-4-enoxycarbonylamino)acetyl]pyrrolidine-2-carboxylate (PubChem CID 145379374) has the molecular formula C32H36N4O8 and a molecular weight of 604.66 g/mol. Its IUPAC name is methyl (4R)-4-[3-(3-ethenylphenyl)-6,7-dimethoxyquinoxalin-2-yl]oxy-1-[2-(pent-4-enoxycarbonylamino)acetyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (4R)-4-[3-(3-ethenylphenyl)-6,7-dimethoxyquinoxalin-2-yl]oxy-1-[2-(pent-4-enoxycarbonylamino)acetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 145379374 |
| Molecular Formula | C32H36N4O8 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | methyl (4R)-4-[3-(3-ethenylphenyl)-6,7-dimethoxyquinoxalin-2-yl]oxy-1-[2-(pent-4-enoxycarbonylamino)acetyl]pyrrolidine-2-carboxylate |
| SMILES | C=CCCCOC(=O)NCC(=O)N1C[C@H](Oc2nc3cc(OC)c(OC)cc3nc2-c2cccc(C=C)c2)CC1C(=O)OC |
| InChI | InChI=1S/C32H36N4O8/c1-6-8-9-13-43-32(39)33-18-28(37)36-19-22(15-25(36)31(38)42-5)44-30-29(21-12-10-11-20(7-2)14-21)34-23-16-26(40-3)27(41-4)17-24(23)35-30/h6-7,10-12,14,16-17,22,25H,1-2,8-9,13,15,18-19H2,3-5H3,(H,33,39)/t22-,25?/m1/s1 |
| InChIKey | RCPPWCVCAMABAD-UFUCKMQHSA-N |
| XLogP | 4.17 |
| TPSA | 138.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|