C26H28N2O5 — CID 59408866
1-O-tert-butyl 2-O-methyl (2S,4R)-4-(8-ethenylphenanthridin-6-yl)oxypyrrolidine-1,2-dicarboxylate (PubChem CID 59408866) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(8-ethenylphenanthridin-6-yl)oxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(8-ethenylphenanthridin-6-yl)oxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59408866 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(8-ethenylphenanthridin-6-yl)oxypyrrolidine-1,2-dicarboxylate |
| SMILES | C=Cc1ccc2c(c1)c(O[C@@H]1C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C1)nc1ccccc12 |
| InChI | InChI=1S/C26H28N2O5/c1-6-16-11-12-18-19-9-7-8-10-21(19)27-23(20(18)13-16)32-17-14-22(24(29)31-5)28(15-17)25(30)33-26(2,3)4/h6-13,17,22H,1,14-15H2,2-5H3/t17-,22+/m1/s1 |
| InChIKey | IDSJHJWRFYZXNB-VGSWGCGISA-N |
| XLogP | 4.96 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|