C26H28N2O5 — CID 91275341
(2S,4R)-4-(8-ethenylphenanthridin-6-yl)oxy-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 91275341) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is (2S,4R)-4-(8-ethenylphenanthridin-6-yl)oxy-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-(8-ethenylphenanthridin-6-yl)oxy-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 91275341 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (2S,4R)-4-(8-ethenylphenanthridin-6-yl)oxy-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | C=Cc1ccc2c(c1)c(O[C@H]1CN(C(=O)OC(C)(C)C)[C@](C)(C(=O)O)C1)nc1ccccc12 |
| InChI | InChI=1S/C26H28N2O5/c1-6-16-11-12-18-19-9-7-8-10-21(19)27-22(20(18)13-16)32-17-14-26(5,23(29)30)28(15-17)24(31)33-25(2,3)4/h6-13,17H,1,14-15H2,2-5H3,(H,29,30)/t17-,26+/m1/s1 |
| InChIKey | VVOJKLRCWNKXSF-QUGAMOGWSA-N |
| XLogP | 5.26 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|