C23H24N2O5 — CID 67296724
1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenanthridin-6-yloxypyrrolidine-2-carboxylic acid (PubChem CID 67296724) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenanthridin-6-yloxypyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenanthridin-6-yloxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67296724 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenanthridin-6-yloxypyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2nc3ccccc3c3ccccc23)CC1C(=O)O |
| InChI | InChI=1S/C23H24N2O5/c1-23(2,3)30-22(28)25-13-14(12-19(25)21(26)27)29-20-17-10-5-4-8-15(17)16-9-6-7-11-18(16)24-20/h4-11,14,19H,12-13H2,1-3H3,(H,26,27) |
| InChIKey | QNDQDFDULWZXJH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|