C36H35N5O5 — CID 123832554
tert-butyl 2-[[2-ethenyl-1-(indazole-1-carbonyl)cyclopropyl]carbamoyl]-4-phenanthridin-6-yloxypyrrolidine-1-carboxylate (PubChem CID 123832554) has the molecular formula C36H35N5O5 and a molecular weight of 617.71 g/mol. Its IUPAC name is tert-butyl 2-[[2-ethenyl-1-(indazole-1-carbonyl)cyclopropyl]carbamoyl]-4-phenanthridin-6-yloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[2-ethenyl-1-(indazole-1-carbonyl)cyclopropyl]carbamoyl]-4-phenanthridin-6-yloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123832554 |
| Molecular Formula | C36H35N5O5 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | tert-butyl 2-[[2-ethenyl-1-(indazole-1-carbonyl)cyclopropyl]carbamoyl]-4-phenanthridin-6-yloxypyrrolidine-1-carboxylate |
| SMILES | C=CC1CC1(NC(=O)C1CC(Oc2nc3ccccc3c3ccccc23)CN1C(=O)OC(C)(C)C)C(=O)n1ncc2ccccc21 |
| InChI | InChI=1S/C36H35N5O5/c1-5-23-19-36(23,33(43)41-29-17-11-6-12-22(29)20-37-41)39-31(42)30-18-24(21-40(30)34(44)46-35(2,3)4)45-32-27-15-8-7-13-25(27)26-14-9-10-16-28(26)38-32/h5-17,20,23-24,30H,1,18-19,21H2,2-4H3,(H,39,42) |
| InChIKey | JXWSIEBFBVBBDF-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|