C27H35N3O4 — CID 59084480
tert-butyl (2S)-2-[[(1R,2R)-2-but-3-enyl-1-methylcyclopropyl]carbamoyl]-4-quinolin-4-yloxypyrrolidine-1-carboxylate (PubChem CID 59084480) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(1R,2R)-2-but-3-enyl-1-methylcyclopropyl]carbamoyl]-4-quinolin-4-yloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[(1R,2R)-2-but-3-enyl-1-methylcyclopropyl]carbamoyl]-4-quinolin-4-yloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59084480 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | tert-butyl (2S)-2-[[(1R,2R)-2-but-3-enyl-1-methylcyclopropyl]carbamoyl]-4-quinolin-4-yloxypyrrolidine-1-carboxylate |
| SMILES | C=CCC[C@@H]1C[C@@]1(C)NC(=O)[C@@H]1CC(Oc2ccnc3ccccc23)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H35N3O4/c1-6-7-10-18-16-27(18,5)29-24(31)22-15-19(17-30(22)25(32)34-26(2,3)4)33-23-13-14-28-21-12-9-8-11-20(21)23/h6,8-9,11-14,18-19,22H,1,7,10,15-17H2,2-5H3,(H,29,31)/t18-,19?,22+,27-/m1/s1 |
| InChIKey | AKKWCBLMJGQARY-QQEAAJKTSA-N |
| XLogP | 4.85 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|