C16H14N2O — CID 143966640
6-methyl-2-(4-methylphenoxy)-1,8-naphthyridine (PubChem CID 143966640) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 6-methyl-2-(4-methylphenoxy)-1,8-naphthyridine.
| Compound Name | 6-methyl-2-(4-methylphenoxy)-1,8-naphthyridine |
|---|---|
| PubChem CID | 143966640 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 6-methyl-2-(4-methylphenoxy)-1,8-naphthyridine |
| SMILES | Cc1ccc(Oc2ccc3cc(C)cnc3n2)cc1 |
| InChI | InChI=1S/C16H14N2O/c1-11-3-6-14(7-4-11)19-15-8-5-13-9-12(2)10-17-16(13)18-15/h3-10H,1-2H3 |
| InChIKey | NJZIUQKQZQNENN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |