C20H19ClFN7O2 — CID 143966832
ethyl 5-[4-[amino-[(Z)-2-aminoethenyl]amino]-2-(3-chloro-4-fluoroanilino)pyrimidin-5-yl]pyridine-3-carboxylate (PubChem CID 143966832) has the molecular formula C20H19ClFN7O2 and a molecular weight of 443.87 g/mol. Its IUPAC name is ethyl 5-[4-[amino-[(Z)-2-aminoethenyl]amino]-2-(3-chloro-4-fluoroanilino)pyrimidin-5-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[4-[amino-[(Z)-2-aminoethenyl]amino]-2-(3-chloro-4-fluoroanilino)pyrimidin-5-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 143966832 |
| Molecular Formula | C20H19ClFN7O2 |
| Molecular Weight | 443.87 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | ethyl 5-[4-[amino-[(Z)-2-aminoethenyl]amino]-2-(3-chloro-4-fluoroanilino)pyrimidin-5-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cncc(-c2cnc(Nc3ccc(F)c(Cl)c3)nc2N(N)/C=C\N)c1 |
| InChI | InChI=1S/C20H19ClFN7O2/c1-2-31-19(30)13-7-12(9-25-10-13)15-11-26-20(28-18(15)29(24)6-5-23)27-14-3-4-17(22)16(21)8-14/h3-11H,2,23-24H2,1H3,(H,26,27,28)/b6-5- |
| InChIKey | SOFPLNMAZMUGHA-WAYWQWQTSA-N |
| XLogP | 3.36 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.87 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|