C18H15ClFN5O2 — CID 59353417
5-[2-(3-chloro-4-fluoroanilino)-4-methylpyrimidin-5-yl]-N-methoxypyridine-3-carboxamide (PubChem CID 59353417) has the molecular formula C18H15ClFN5O2 and a molecular weight of 387.80 g/mol. Its IUPAC name is 5-[2-(3-chloro-4-fluoroanilino)-4-methylpyrimidin-5-yl]-N-methoxypyridine-3-carboxamide.
| Compound Name | 5-[2-(3-chloro-4-fluoroanilino)-4-methylpyrimidin-5-yl]-N-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 59353417 |
| Molecular Formula | C18H15ClFN5O2 |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 5-[2-(3-chloro-4-fluoroanilino)-4-methylpyrimidin-5-yl]-N-methoxypyridine-3-carboxamide |
| SMILES | CONC(=O)c1cncc(-c2cnc(Nc3ccc(F)c(Cl)c3)nc2C)c1 |
| InChI | InChI=1S/C18H15ClFN5O2/c1-10-14(11-5-12(8-21-7-11)17(26)25-27-2)9-22-18(23-10)24-13-3-4-16(20)15(19)6-13/h3-9H,1-2H3,(H,25,26)(H,22,23,24) |
| InChIKey | FWOWXQODQJATKF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|