C21H25ClN6O — CID 143969247
N-[4-[1-[(E)-N'-[amino(methyl)amino]carbamimidoyl]-4-methyl-3,6-dihydro-2H-pyridin-5-yl]phenyl]-2-chlorobenzamide (PubChem CID 143969247) has the molecular formula C21H25ClN6O and a molecular weight of 412.93 g/mol. Its IUPAC name is N-[4-[1-[(E)-N'-[amino(methyl)amino]carbamimidoyl]-4-methyl-3,6-dihydro-2H-pyridin-5-yl]phenyl]-2-chlorobenzamide.
| Compound Name | N-[4-[1-[(E)-N'-[amino(methyl)amino]carbamimidoyl]-4-methyl-3,6-dihydro-2H-pyridin-5-yl]phenyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 143969247 |
| Molecular Formula | C21H25ClN6O |
| Molecular Weight | 412.93 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-[4-[1-[(E)-N'-[amino(methyl)amino]carbamimidoyl]-4-methyl-3,6-dihydro-2H-pyridin-5-yl]phenyl]-2-chlorobenzamide |
| SMILES | CC1=C(c2ccc(NC(=O)c3ccccc3Cl)cc2)CN(/C(N)=N/N(C)N)CC1 |
| InChI | InChI=1S/C21H25ClN6O/c1-14-11-12-28(21(23)26-27(2)24)13-18(14)15-7-9-16(10-8-15)25-20(29)17-5-3-4-6-19(17)22/h3-10H,11-13,24H2,1-2H3,(H2,23,26)(H,25,29) |
| InChIKey | QTIJHEZUIVMRRA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.93 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|