C31H47NO5 — CID 143969407
5-(4-acetylphenyl)pentanal;1-(3,4-dimethoxyphenyl)-2-methyl-3-pyrrolidin-1-ylpropan-1-ol;ethane (PubChem CID 143969407) has the molecular formula C31H47NO5 and a molecular weight of 513.72 g/mol. Its IUPAC name is 5-(4-acetylphenyl)pentanal;1-(3,4-dimethoxyphenyl)-2-methyl-3-pyrrolidin-1-ylpropan-1-ol;ethane.
| Compound Name | 5-(4-acetylphenyl)pentanal;1-(3,4-dimethoxyphenyl)-2-methyl-3-pyrrolidin-1-ylpropan-1-ol;ethane |
|---|---|
| PubChem CID | 143969407 |
| Molecular Formula | C31H47NO5 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.35 |
| IUPAC Name | 5-(4-acetylphenyl)pentanal;1-(3,4-dimethoxyphenyl)-2-methyl-3-pyrrolidin-1-ylpropan-1-ol;ethane |
| SMILES | CC.CC(=O)c1ccc(CCCCC=O)cc1.COc1ccc(C(O)C(C)CN2CCCC2)cc1OC |
| InChI | InChI=1S/C16H25NO3.C13H16O2.C2H6/c1-12(11-17-8-4-5-9-17)16(18)13-6-7-14(19-2)15(10-13)20-3;1-11(15)13-8-6-12(7-9-13)5-3-2-4-10-14;1-2/h6-7,10,12,16,18H,4-5,8-9,11H2,1-3H3;6-10H,2-5H2,1H3;1-2H3 |
| InChIKey | LEPUGFWDIYVDFM-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|