C31H41F3N6O — CID 143970745
2-[4-[1-[8-tert-butyl-3-oxo-2-[4-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]butyl]phenyl]-N'-hydrazinylethanimidamide (PubChem CID 143970745) has the molecular formula C31H41F3N6O and a molecular weight of 570.70 g/mol. Its IUPAC name is 2-[4-[1-[8-tert-butyl-3-oxo-2-[4-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]butyl]phenyl]-N'-hydrazinylethanimidamide.
| Compound Name | 2-[4-[1-[8-tert-butyl-3-oxo-2-[4-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]butyl]phenyl]-N'-hydrazinylethanimidamide |
|---|---|
| PubChem CID | 143970745 |
| Molecular Formula | C31H41F3N6O |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | 2-[4-[1-[8-tert-butyl-3-oxo-2-[4-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]butyl]phenyl]-N'-hydrazinylethanimidamide |
| SMILES | CCCC(c1ccc(C/C(N)=N/NN)cc1)N1C(=O)C(c2ccc(C(F)(F)F)cc2)=NC12CCC(C(C)(C)C)CC2 |
| InChI | InChI=1S/C31H41F3N6O/c1-5-6-25(21-9-7-20(8-10-21)19-26(35)38-39-36)40-28(41)27(22-11-13-24(14-12-22)31(32,33)34)37-30(40)17-15-23(16-18-30)29(2,3)4/h7-14,23,25,39H,5-6,15-19,36H2,1-4H3,(H2,35,38) |
| InChIKey | ZTHXBHOYCTWERD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|