C33H44FN5O2 — CID 143970586
N-(2-amino-2-iminoethyl)-4-[(1R)-1-[8-tert-butyl-2-(4-fluorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4-methylpentyl]benzamide (PubChem CID 143970586) has the molecular formula C33H44FN5O2 and a molecular weight of 561.75 g/mol. Its IUPAC name is N-(2-amino-2-iminoethyl)-4-[(1R)-1-[8-tert-butyl-2-(4-fluorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4-methylpentyl]benzamide.
| Compound Name | N-(2-amino-2-iminoethyl)-4-[(1R)-1-[8-tert-butyl-2-(4-fluorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4-methylpentyl]benzamide |
|---|---|
| PubChem CID | 143970586 |
| Molecular Formula | C33H44FN5O2 |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.35 |
| IUPAC Name | N-(2-amino-2-iminoethyl)-4-[(1R)-1-[8-tert-butyl-2-(4-fluorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4-methylpentyl]benzamide |
| SMILES | [H]/N=C(\N)CNC(=O)c1ccc([C@@H](CCC(C)C)N2C(=O)C(c3ccc(F)cc3)=NC23CCC(C(C)(C)C)CC3)cc1 |
| InChI | InChI=1S/C33H44FN5O2/c1-21(2)6-15-27(22-7-9-24(10-8-22)30(40)37-20-28(35)36)39-31(41)29(23-11-13-26(34)14-12-23)38-33(39)18-16-25(17-19-33)32(3,4)5/h7-14,21,25,27H,6,15-20H2,1-5H3,(H3,35,36)(H,37,40)/t25?,27-,33?/m1/s1 |
| InChIKey | CSZMVCAHOFWMKO-MNHRABBLSA-N |
| XLogP | 6.23 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|