C31H38ClN5O2 — CID 76730433
N-(2-amino-2-iminoethyl)-4-[[8-tert-butyl-2-(4-chlorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-cyclopropylmethyl]benzamide (PubChem CID 76730433) has the molecular formula C31H38ClN5O2 and a molecular weight of 548.13 g/mol. Its IUPAC name is N-(2-amino-2-iminoethyl)-4-[[8-tert-butyl-2-(4-chlorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-cyclopropylmethyl]benzamide.
| Compound Name | N-(2-amino-2-iminoethyl)-4-[[8-tert-butyl-2-(4-chlorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-cyclopropylmethyl]benzamide |
|---|---|
| PubChem CID | 76730433 |
| Molecular Formula | C31H38ClN5O2 |
| Molecular Weight | 548.13 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | N-(2-amino-2-iminoethyl)-4-[[8-tert-butyl-2-(4-chlorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-cyclopropylmethyl]benzamide |
| SMILES | [H]/N=C(\N)CNC(=O)c1ccc(C(C2CC2)N2C(=O)C(c3ccc(Cl)cc3)=NC23CCC(C(C)(C)C)CC3)cc1 |
| InChI | InChI=1S/C31H38ClN5O2/c1-30(2,3)23-14-16-31(17-15-23)36-26(19-10-12-24(32)13-11-19)29(39)37(31)27(20-4-5-20)21-6-8-22(9-7-21)28(38)35-18-25(33)34/h6-13,20,23,27H,4-5,14-18H2,1-3H3,(H3,33,34)(H,35,38) |
| InChIKey | RBJDBPYQNNEDKR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.13 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|