C31H34N4O2 — CID 143971236
1-[(2R)-2-(dimethylamino)-2-phenylacetyl]-N-[4-[2-[4-(dimethylamino)phenyl]ethynyl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 143971236) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 1-[(2R)-2-(dimethylamino)-2-phenylacetyl]-N-[4-[2-[4-(dimethylamino)phenyl]ethynyl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[(2R)-2-(dimethylamino)-2-phenylacetyl]-N-[4-[2-[4-(dimethylamino)phenyl]ethynyl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143971236 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 1-[(2R)-2-(dimethylamino)-2-phenylacetyl]-N-[4-[2-[4-(dimethylamino)phenyl]ethynyl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | CN(C)c1ccc(C#Cc2ccc(NC(=O)C3CCCN3C(=O)[C@@H](c3ccccc3)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H34N4O2/c1-33(2)27-20-16-24(17-21-27)13-12-23-14-18-26(19-15-23)32-30(36)28-11-8-22-35(28)31(37)29(34(3)4)25-9-6-5-7-10-25/h5-7,9-10,14-21,28-29H,8,11,22H2,1-4H3,(H,32,36)/t28?,29-/m1/s1 |
| InChIKey | SHHSTWAPLPYDOS-YPJJGMIRSA-N |
| XLogP | 4.38 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|