C21H20F3N — CID 143972555
(Z)-2-[(9S)-2-ethyl-9-(trifluoromethyl)-9H-fluoren-4-yl]-N-methylbut-2-en-1-imine (PubChem CID 143972555) has the molecular formula C21H20F3N and a molecular weight of 343.39 g/mol. Its IUPAC name is (Z)-2-[(9S)-2-ethyl-9-(trifluoromethyl)-9H-fluoren-4-yl]-N-methylbut-2-en-1-imine.
| Compound Name | (Z)-2-[(9S)-2-ethyl-9-(trifluoromethyl)-9H-fluoren-4-yl]-N-methylbut-2-en-1-imine |
|---|---|
| PubChem CID | 143972555 |
| Molecular Formula | C21H20F3N |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (Z)-2-[(9S)-2-ethyl-9-(trifluoromethyl)-9H-fluoren-4-yl]-N-methylbut-2-en-1-imine |
| SMILES | C/C=C(\C=N\C)c1cc(CC)cc2c1-c1ccccc1[C@@H]2C(F)(F)F |
| InChI | InChI=1S/C21H20F3N/c1-4-13-10-17(14(5-2)12-25-3)19-15-8-6-7-9-16(15)20(18(19)11-13)21(22,23)24/h5-12,20H,4H2,1-3H3/b14-5+,25-12+/t20-/m0/s1 |
| InChIKey | ZOCBUOSHUWGKIT-NZHZWZHFSA-N |
| XLogP | 6.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|