C35H30F6N2O2 — CID 143972795
2-tert-butyl-5-[2-[2-(4-tert-butylnaphthalen-1-yl)-1,3-benzoxazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-benzoxazole (PubChem CID 143972795) has the molecular formula C35H30F6N2O2 and a molecular weight of 624.63 g/mol. Its IUPAC name is 2-tert-butyl-5-[2-[2-(4-tert-butylnaphthalen-1-yl)-1,3-benzoxazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-benzoxazole.
| Compound Name | 2-tert-butyl-5-[2-[2-(4-tert-butylnaphthalen-1-yl)-1,3-benzoxazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 143972795 |
| Molecular Formula | C35H30F6N2O2 |
| Molecular Weight | 624.63 g/mol |
| Exact Mass | 624.22 |
| IUPAC Name | 2-tert-butyl-5-[2-[2-(4-tert-butylnaphthalen-1-yl)-1,3-benzoxazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-benzoxazole |
| SMILES | CC(C)(C)c1nc2cc(C(c3ccc4oc(-c5ccc(C(C)(C)C)c6ccccc56)nc4c3)(C(F)(F)F)C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C35H30F6N2O2/c1-31(2,3)24-14-13-23(21-9-7-8-10-22(21)24)29-42-25-17-19(11-15-27(25)44-29)33(34(36,37)38,35(39,40)41)20-12-16-28-26(18-20)43-30(45-28)32(4,5)6/h7-18H,1-6H3 |
| InChIKey | IBODWNJNNKOBRX-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.63 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |