C20H30N2O2 — CID 143973321
3-(3-ethenyl-6-methoxyindol-1-yl)-N,N-dimethylpropan-1-amine;(E)-1-methoxyprop-1-ene (PubChem CID 143973321) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 3-(3-ethenyl-6-methoxyindol-1-yl)-N,N-dimethylpropan-1-amine;(E)-1-methoxyprop-1-ene.
| Compound Name | 3-(3-ethenyl-6-methoxyindol-1-yl)-N,N-dimethylpropan-1-amine;(E)-1-methoxyprop-1-ene |
|---|---|
| PubChem CID | 143973321 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 3-(3-ethenyl-6-methoxyindol-1-yl)-N,N-dimethylpropan-1-amine;(E)-1-methoxyprop-1-ene |
| SMILES | C/C=C/OC.C=Cc1cn(CCCN(C)C)c2cc(OC)ccc12 |
| InChI | InChI=1S/C16H22N2O.C4H8O/c1-5-13-12-18(10-6-9-17(2)3)16-11-14(19-4)7-8-15(13)16;1-3-4-5-2/h5,7-8,11-12H,1,6,9-10H2,2-4H3;3-4H,1-2H3/b;4-3+ |
| InChIKey | HCELFCYDIRFKKB-SCBDLNNBSA-N |
| XLogP | 4.41 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|