C29H34ClNO4S2 — CID 143973814
2-(4-chlorophenyl)-5-[4-[3-[ethyl-(1-hydroxy-3-methylbutylidene)-λ4-sulfanyl]propoxy]-3-methoxyphenyl]-4H-thieno[2,3-c]pyrrol-6-one (PubChem CID 143973814) has the molecular formula C29H34ClNO4S2 and a molecular weight of 560.18 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-[4-[3-[ethyl-(1-hydroxy-3-methylbutylidene)-λ4-sulfanyl]propoxy]-3-methoxyphenyl]-4H-thieno[2,3-c]pyrrol-6-one.
| Compound Name | 2-(4-chlorophenyl)-5-[4-[3-[ethyl-(1-hydroxy-3-methylbutylidene)-λ4-sulfanyl]propoxy]-3-methoxyphenyl]-4H-thieno[2,3-c]pyrrol-6-one |
|---|---|
| PubChem CID | 143973814 |
| Molecular Formula | C29H34ClNO4S2 |
| Molecular Weight | 560.18 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 2-(4-chlorophenyl)-5-[4-[3-[ethyl-(1-hydroxy-3-methylbutylidene)-λ4-sulfanyl]propoxy]-3-methoxyphenyl]-4H-thieno[2,3-c]pyrrol-6-one |
| SMILES | CCS(CCCOc1ccc(N2Cc3cc(-c4ccc(Cl)cc4)sc3C2=O)cc1OC)=C(O)CC(C)C |
| InChI | InChI=1S/C29H34ClNO4S2/c1-5-37(27(32)15-19(2)3)14-6-13-35-24-12-11-23(17-25(24)34-4)31-18-21-16-26(36-28(21)29(31)33)20-7-9-22(30)10-8-20/h7-12,16-17,19,32H,5-6,13-15,18H2,1-4H3 |
| InChIKey | HWEXTWZCECXJNX-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.18 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|