About ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate
ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate (PubChem CID 143973901) has the molecular formula C12H26N2O3
and a molecular weight of 246.35 g/mol. Its IUPAC name is ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate.
Molecular Properties
| Compound Name | ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate |
| PubChem CID | 143973901 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate |
| SMILES | CC.CCN(C(=O)OCCO)C1CCN(C)C1 |
| InChI | InChI=1S/C10H20N2O3.C2H6/c1-3-12(10(14)15-7-6-13)9-4-5-11(2)8-9;1-2/h9,13H,3-8H2,1-2H3;1-2H3 |
| InChIKey | CDUUXSMYQJEGPW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate?
The IUPAC name of ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate (CID 143973901) is ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate.
What is the SMILES notation for ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate?
The canonical SMILES for ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate is CC.CCN(C(=O)OCCO)C1CCN(C)C1.
What is the InChIKey of ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate?
The InChIKey is CDUUXSMYQJEGPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3.C2H6/c1-3-12(10(14)15-7-6-13)9-4-5-11(2)8-9;1-2/h9,13H,3-8H2,1-2H3;1-2H3.
What are the key properties of ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate?
ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate has a molecular weight of 246.35 g/mol, XLogP of 1.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-hydroxyethyl N-ethyl-N-(1-methylpyrrolidin-3-yl)carbamate is sourced from PubChem (CID 143973901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).