C16H16FN9 — CID 143973959
N-amino-N-[3-[(8-amino-3-cyanoimidazo[1,2-b]pyridazin-6-yl)amino]-5-fluorophenyl]-N'-ethylmethanimidamide (PubChem CID 143973959) has the molecular formula C16H16FN9 and a molecular weight of 353.37 g/mol. Its IUPAC name is N-amino-N-[3-[(8-amino-3-cyanoimidazo[1,2-b]pyridazin-6-yl)amino]-5-fluorophenyl]-N'-ethylmethanimidamide.
| Compound Name | N-amino-N-[3-[(8-amino-3-cyanoimidazo[1,2-b]pyridazin-6-yl)amino]-5-fluorophenyl]-N'-ethylmethanimidamide |
|---|---|
| PubChem CID | 143973959 |
| Molecular Formula | C16H16FN9 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-amino-N-[3-[(8-amino-3-cyanoimidazo[1,2-b]pyridazin-6-yl)amino]-5-fluorophenyl]-N'-ethylmethanimidamide |
| SMILES | CC/N=C/N(N)c1cc(F)cc(Nc2cc(N)c3ncc(C#N)n3n2)c1 |
| InChI | InChI=1S/C16H16FN9/c1-2-21-9-25(20)12-4-10(17)3-11(5-12)23-15-6-14(19)16-22-8-13(7-18)26(16)24-15/h3-6,8-9H,2,19-20H2,1H3,(H,23,24)/b21-9+ |
| InChIKey | FQBBYGFMUSQHFN-ZVBGSRNCSA-N |
| XLogP | 1.79 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|