C8H15NO4S — CID 143974354
(2S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbothioylamino]propanoic acid (PubChem CID 143974354) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbothioylamino]propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbothioylamino]propanoic acid |
|---|---|
| PubChem CID | 143974354 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (2S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbothioylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=S)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C8H15NO4S/c1-8(2,3)13-7(14)9-4-5(10)6(11)12/h5,10H,4H2,1-3H3,(H,9,14)(H,11,12)/t5-/m0/s1 |
| InChIKey | MBSPDJLUMAUVJK-YFKPBYRVSA-N |
| XLogP | 0.12 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|