About methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone
methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone (PubChem CID 143976180) has the molecular formula C24H38O
and a molecular weight of 342.57 g/mol. Its IUPAC name is methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone.
Molecular Properties
| Compound Name | methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone |
| PubChem CID | 143976180 |
| Molecular Formula | C24H38O |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone |
| SMILES | C=CCC(Cc1cc(C(C)=O)ccc1C)C(C)C.CC1CCCCC1 |
| InChI | InChI=1S/C17H24O.C7H14/c1-6-7-15(12(2)3)10-17-11-16(14(5)18)9-8-13(17)4;1-7-5-3-2-4-6-7/h6,8-9,11-12,15H,1,7,10H2,2-5H3;7H,2-6H2,1H3 |
| InChIKey | MKJPLZPWKZNXQY-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone?
The IUPAC name of methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone (CID 143976180) is methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone.
What is the SMILES notation for methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone?
The canonical SMILES for methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone is C=CCC(Cc1cc(C(C)=O)ccc1C)C(C)C.CC1CCCCC1.
What is the InChIKey of methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone?
The InChIKey is MKJPLZPWKZNXQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O.C7H14/c1-6-7-15(12(2)3)10-17-11-16(14(5)18)9-8-13(17)4;1-7-5-3-2-4-6-7/h6,8-9,11-12,15H,1,7,10H2,2-5H3;7H,2-6H2,1H3.
What are the key properties of methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone?
methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone has a molecular weight of 342.57 g/mol, XLogP of 7.18, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylcyclohexane;1-[4-methyl-3-(2-propan-2-ylpent-4-enyl)phenyl]ethanone is sourced from PubChem (CID 143976180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).