C18H27NO2 — CID 82351068
3-(cyclohexylamino)-4-(2,5-dimethylphenyl)butanoic acid (PubChem CID 82351068) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-(cyclohexylamino)-4-(2,5-dimethylphenyl)butanoic acid.
| Compound Name | 3-(cyclohexylamino)-4-(2,5-dimethylphenyl)butanoic acid |
|---|---|
| PubChem CID | 82351068 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 3-(cyclohexylamino)-4-(2,5-dimethylphenyl)butanoic acid |
| SMILES | Cc1ccc(C)c(CC(CC(=O)O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C18H27NO2/c1-13-8-9-14(2)15(10-13)11-17(12-18(20)21)19-16-6-4-3-5-7-16/h8-10,16-17,19H,3-7,11-12H2,1-2H3,(H,20,21) |
| InChIKey | HRQKCSOYLPWKPE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |