4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid

C16H25NO2 — CID 82351058

IUPAC4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid
SMILESCc1ccc(C)c(CC(CC(=O)O)NCC(C)C)c1
InChIInChI=1S/C16H25NO2/c1-11(2)10-17-15(9-16(18)19)8-14-7-12(3)5-6-13(14)4/h5-7,11,15,17H,8-10H2,1-4H3,(H,18,19)
InChIKeyGCOJOAHXRFKTLD-UHFFFAOYSA-N
MW263.38 g/mol
LogP2.93
Rot. Bonds7

About 4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid

4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid (PubChem CID 82351058) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid.

Molecular Properties

Compound Name4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid
PubChem CID82351058
Molecular FormulaC16H25NO2
Molecular Weight263.38 g/mol
Exact Mass263.19
IUPAC Name4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid
SMILESCc1ccc(C)c(CC(CC(=O)O)NCC(C)C)c1
InChIInChI=1S/C16H25NO2/c1-11(2)10-17-15(9-16(18)19)8-14-7-12(3)5-6-13(14)4/h5-7,11,15,17H,8-10H2,1-4H3,(H,18,19)
InChIKeyGCOJOAHXRFKTLD-UHFFFAOYSA-N
XLogP2.93
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.38
LogP ≤ 52.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid?
The IUPAC name of 4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid (CID 82351058) is 4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid.
What is the SMILES notation for 4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid?
The canonical SMILES for 4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid is Cc1ccc(C)c(CC(CC(=O)O)NCC(C)C)c1.
What is the InChIKey of 4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid?
The InChIKey is GCOJOAHXRFKTLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-11(2)10-17-15(9-16(18)19)8-14-7-12(3)5-6-13(14)4/h5-7,11,15,17H,8-10H2,1-4H3,(H,18,19).
What are the key properties of 4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid?
4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid has a molecular weight of 263.38 g/mol, XLogP of 2.93, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dimethylphenyl)-3-(2-methylpropylamino)butanoic acid is sourced from PubChem (CID 82351058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).