C22H22N6O2 — CID 143976758
methyl N-methyl-5-[5-methyl-2-(pyridin-2-ylmethylcarbamoyl)-1H-imidazol-4-yl]-1H-indole-2-carboximidate (PubChem CID 143976758) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is methyl N-methyl-5-[5-methyl-2-(pyridin-2-ylmethylcarbamoyl)-1H-imidazol-4-yl]-1H-indole-2-carboximidate.
| Compound Name | methyl N-methyl-5-[5-methyl-2-(pyridin-2-ylmethylcarbamoyl)-1H-imidazol-4-yl]-1H-indole-2-carboximidate |
|---|---|
| PubChem CID | 143976758 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | methyl N-methyl-5-[5-methyl-2-(pyridin-2-ylmethylcarbamoyl)-1H-imidazol-4-yl]-1H-indole-2-carboximidate |
| SMILES | C/N=C(\OC)c1cc2cc(-c3nc(C(=O)NCc4ccccn4)[nH]c3C)ccc2[nH]1 |
| InChI | InChI=1S/C22H22N6O2/c1-13-19(28-20(26-13)21(29)25-12-16-6-4-5-9-24-16)14-7-8-17-15(10-14)11-18(27-17)22(23-2)30-3/h4-11,27H,12H2,1-3H3,(H,25,29)(H,26,28)/b23-22- |
| InChIKey | VHRIDIHLOBEMKY-FCQUAONHSA-N |
| XLogP | 3.21 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|