C20H23N3O2 — CID 143978228
4-[[5-(1,3-dihydroisoindol-2-ylmethyl)-2-pyridinyl]oxy]piperidine-1-carbaldehyde (PubChem CID 143978228) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)-2-pyridinyl]oxy]piperidine-1-carbaldehyde.
| Compound Name | 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)-2-pyridinyl]oxy]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 143978228 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)-2-pyridinyl]oxy]piperidine-1-carbaldehyde |
| SMILES | O=CN1CCC(Oc2ccc(CN3Cc4ccccc4C3)cn2)CC1 |
| InChI | InChI=1S/C20H23N3O2/c24-15-22-9-7-19(8-10-22)25-20-6-5-16(11-21-20)12-23-13-17-3-1-2-4-18(17)14-23/h1-6,11,15,19H,7-10,12-14H2 |
| InChIKey | DQLXEACOBJJNPF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|