C13H20O2S2 — CID 143979116
ethoxymethanethioic S-acid;(4-propan-2-ylphenyl)methanethiol (PubChem CID 143979116) has the molecular formula C13H20O2S2 and a molecular weight of 272.44 g/mol. Its IUPAC name is ethoxymethanethioic S-acid;(4-propan-2-ylphenyl)methanethiol.
| Compound Name | ethoxymethanethioic S-acid;(4-propan-2-ylphenyl)methanethiol |
|---|---|
| PubChem CID | 143979116 |
| Molecular Formula | C13H20O2S2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | ethoxymethanethioic S-acid;(4-propan-2-ylphenyl)methanethiol |
| SMILES | CC(C)c1ccc(CS)cc1.CCOC(=O)S |
| InChI | InChI=1S/C10H14S.C3H6O2S/c1-8(2)10-5-3-9(7-11)4-6-10;1-2-5-3(4)6/h3-6,8,11H,7H2,1-2H3;2H2,1H3,(H,4,6) |
| InChIKey | FKSIRACJROOSAW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|