C12H21N2O+ — CID 143979554
ethane;1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one (PubChem CID 143979554) has the molecular formula C12H21N2O+ and a molecular weight of 209.31 g/mol. Its IUPAC name is ethane;1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one.
| Compound Name | ethane;1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one |
|---|---|
| PubChem CID | 143979554 |
| Molecular Formula | C12H21N2O+ |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | ethane;1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one |
| SMILES | C=CCn1c(C)cc(C)[n+](C)c1=O.CC |
| InChI | InChI=1S/C10H15N2O.C2H6/c1-5-6-12-9(3)7-8(2)11(4)10(12)13;1-2/h5,7H,1,6H2,2-4H3;1-2H3/q+1; |
| InChIKey | PYBBAAMYKSKVHZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|