C20H20IN3O5S — CID 143979858
cyclohexylmethyl 6-(2-iodosulfanylethynyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 143979858) has the molecular formula C20H20IN3O5S and a molecular weight of 541.37 g/mol. Its IUPAC name is cyclohexylmethyl 6-(2-iodosulfanylethynyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | cyclohexylmethyl 6-(2-iodosulfanylethynyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 143979858 |
| Molecular Formula | C20H20IN3O5S |
| Molecular Weight | 541.37 g/mol |
| Exact Mass | 541.02 |
| IUPAC Name | cyclohexylmethyl 6-(2-iodosulfanylethynyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | O=C1NC(C#CSI)=C(C(=O)OCC2CCCCC2)C(c2cccc([N+](=O)[O-])c2)N1 |
| InChI | InChI=1S/C20H20IN3O5S/c21-30-10-9-16-17(19(25)29-12-13-5-2-1-3-6-13)18(23-20(26)22-16)14-7-4-8-15(11-14)24(27)28/h4,7-8,11,13,18H,1-3,5-6,12H2,(H2,22,23,26) |
| InChIKey | UCXVZKTVRXXSKC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|