C22H27NO5S — CID 143981454
propan-2-yl 4-[3-(4-methylsulfonylphenyl)phenoxy]piperidine-1-carboxylate (PubChem CID 143981454) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is propan-2-yl 4-[3-(4-methylsulfonylphenyl)phenoxy]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[3-(4-methylsulfonylphenyl)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143981454 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | propan-2-yl 4-[3-(4-methylsulfonylphenyl)phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCC(Oc2cccc(-c3ccc(S(C)(=O)=O)cc3)c2)CC1 |
| InChI | InChI=1S/C22H27NO5S/c1-16(2)27-22(24)23-13-11-19(12-14-23)28-20-6-4-5-18(15-20)17-7-9-21(10-8-17)29(3,25)26/h4-10,15-16,19H,11-14H2,1-3H3 |
| InChIKey | QXPOBXRUEZCOQT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |