C24H27FN2O5S — CID 68846633
propan-2-yl 4-[1-(2-fluoro-4-methylsulfonylphenyl)indol-4-yl]oxypiperidine-1-carboxylate (PubChem CID 68846633) has the molecular formula C24H27FN2O5S and a molecular weight of 474.55 g/mol. Its IUPAC name is propan-2-yl 4-[1-(2-fluoro-4-methylsulfonylphenyl)indol-4-yl]oxypiperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[1-(2-fluoro-4-methylsulfonylphenyl)indol-4-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 68846633 |
| Molecular Formula | C24H27FN2O5S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | propan-2-yl 4-[1-(2-fluoro-4-methylsulfonylphenyl)indol-4-yl]oxypiperidine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCC(Oc2cccc3c2ccn3-c2ccc(S(C)(=O)=O)cc2F)CC1 |
| InChI | InChI=1S/C24H27FN2O5S/c1-16(2)31-24(28)26-12-9-17(10-13-26)32-23-6-4-5-21-19(23)11-14-27(21)22-8-7-18(15-20(22)25)33(3,29)30/h4-8,11,14-17H,9-10,12-13H2,1-3H3 |
| InChIKey | RCKQWWRZVQUCRS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |