About 4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane
4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane (PubChem CID 143982718) has the molecular formula C19H21NO5
and a molecular weight of 343.38 g/mol. Its IUPAC name is 4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane.
Molecular Properties
| Compound Name | 4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane |
| PubChem CID | 143982718 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane |
| SMILES | CCOc1ccc(C#Cc2ccc(C=O)c(OCO)c2)cn1.COC |
| InChI | InChI=1S/C17H15NO4.C2H6O/c1-2-21-17-8-6-14(10-18-17)4-3-13-5-7-15(11-19)16(9-13)22-12-20;1-3-2/h5-11,20H,2,12H2,1H3;1-2H3 |
| InChIKey | ZQLFXARGYSSJBU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane?
The IUPAC name of 4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane (CID 143982718) is 4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane.
What is the SMILES notation for 4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane?
The canonical SMILES for 4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane is CCOc1ccc(C#Cc2ccc(C=O)c(OCO)c2)cn1.COC.
What is the InChIKey of 4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane?
The InChIKey is ZQLFXARGYSSJBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO4.C2H6O/c1-2-21-17-8-6-14(10-18-17)4-3-13-5-7-15(11-19)16(9-13)22-12-20;1-3-2/h5-11,20H,2,12H2,1H3;1-2H3.
What are the key properties of 4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane?
4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane has a molecular weight of 343.38 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(6-ethoxy-3-pyridinyl)ethynyl]-2-(hydroxymethoxy)benzaldehyde;methoxymethane is sourced from PubChem (CID 143982718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).