C10H19N3 — CID 143982726
(Z)-3-methylhex-2-ene;5-methyl-1H-1,2,4-triazole (PubChem CID 143982726) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is (Z)-3-methylhex-2-ene;5-methyl-1H-1,2,4-triazole.
| Compound Name | (Z)-3-methylhex-2-ene;5-methyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 143982726 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | (Z)-3-methylhex-2-ene;5-methyl-1H-1,2,4-triazole |
| SMILES | C/C=C(/C)CCC.Cc1ncn[nH]1 |
| InChI | InChI=1S/C7H14.C3H5N3/c1-4-6-7(3)5-2;1-3-4-2-5-6-3/h5H,4,6H2,1-3H3;2H,1H3,(H,4,5,6)/b7-5-; |
| InChIKey | ADOCGKPLWUCZDJ-YJOCEBFMSA-N |
| XLogP | 2.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|