C63H55NS — CID 143984017
(7aS)-N-[9,9-diethyl-7-[(E)-2-(2,3,4,5-tetraphenylphenyl)ethenyl]fluoren-2-yl]-N-phenyl-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-2-amine (PubChem CID 143984017) has the molecular formula C63H55NS and a molecular weight of 858.21 g/mol. Its IUPAC name is (7aS)-N-[9,9-diethyl-7-[(E)-2-(2,3,4,5-tetraphenylphenyl)ethenyl]fluoren-2-yl]-N-phenyl-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-2-amine.
| Compound Name | (7aS)-N-[9,9-diethyl-7-[(E)-2-(2,3,4,5-tetraphenylphenyl)ethenyl]fluoren-2-yl]-N-phenyl-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-2-amine |
|---|---|
| PubChem CID | 143984017 |
| Molecular Formula | C63H55NS |
| Molecular Weight | 858.21 g/mol |
| Exact Mass | 857.41 |
| IUPAC Name | (7aS)-N-[9,9-diethyl-7-[(E)-2-(2,3,4,5-tetraphenylphenyl)ethenyl]fluoren-2-yl]-N-phenyl-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-2-amine |
| SMILES | CCC1(CC)c2cc(/C=C/c3cc(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c3-c3ccccc3)ccc2-c2ccc(N(C3=CC4CCCC[C@@H]4S3)c3ccccc3)cc21 |
| InChI | InChI=1S/C63H55NS/c1-3-63(4-2)56-40-44(35-38-53(56)54-39-37-52(43-57(54)63)64(51-31-18-9-19-32-51)59-42-49-30-20-21-33-58(49)65-59)34-36-50-41-55(45-22-10-5-11-23-45)61(47-26-14-7-15-27-47)62(48-28-16-8-17-29-48)60(50)46-24-12-6-13-25-46/h5-19,22-29,31-32,34-43,49,58H,3-4,20-21,30,33H2,1-2H3/b36-34+/t49?,58-/m0/s1 |
| InChIKey | OXNGIDMHMCZZHR-XABHYKIXSA-N |
| XLogP | 17.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.21 |
| LogP ≤ 5 | 17.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|