C19H33NO — CID 143986694
2-[[(2R)-3-amino-1,2,3,5,6,7,8,8a-octahydronaphthalen-2-yl]methyl]oct-1-en-4-ol (PubChem CID 143986694) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 2-[[(2R)-3-amino-1,2,3,5,6,7,8,8a-octahydronaphthalen-2-yl]methyl]oct-1-en-4-ol.
| Compound Name | 2-[[(2R)-3-amino-1,2,3,5,6,7,8,8a-octahydronaphthalen-2-yl]methyl]oct-1-en-4-ol |
|---|---|
| PubChem CID | 143986694 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 2-[[(2R)-3-amino-1,2,3,5,6,7,8,8a-octahydronaphthalen-2-yl]methyl]oct-1-en-4-ol |
| SMILES | C=C(CC(O)CCCC)C[C@H]1CC2CCCCC2=CC1N |
| InChI | InChI=1S/C19H33NO/c1-3-4-9-18(21)11-14(2)10-17-12-15-7-5-6-8-16(15)13-19(17)20/h13,15,17-19,21H,2-12,20H2,1H3/t15?,17-,18?,19?/m0/s1 |
| InChIKey | WRZSNZTWUTYKFH-BGDKIBOASA-N |
| XLogP | 4.34 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|