C7H12N2O — CID 143987842
(E)-3-methoxyhex-3-ene-2,5-diimine (PubChem CID 143987842) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is (E)-3-methoxyhex-3-ene-2,5-diimine.
| Compound Name | (E)-3-methoxyhex-3-ene-2,5-diimine |
|---|---|
| PubChem CID | 143987842 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (E)-3-methoxyhex-3-ene-2,5-diimine |
| SMILES | [H]/N=C(C)/C=C(OC)\C(C)=N\[H] |
| InChI | InChI=1S/C7H12N2O/c1-5(8)4-7(10-3)6(2)9/h4,8-9H,1-3H3/b7-4+,8-5+,9-6+ |
| InChIKey | HFBIDTKNBQBMAB-OTWDQPKHSA-N |
| XLogP | 1.60 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|