C9H11F3O — CID 143987869
2-(3,4,5-trifluorocyclohexa-1,3-dien-1-yl)propan-1-ol (PubChem CID 143987869) has the molecular formula C9H11F3O and a molecular weight of 192.18 g/mol. Its IUPAC name is 2-(3,4,5-trifluorocyclohexa-1,3-dien-1-yl)propan-1-ol.
| Compound Name | 2-(3,4,5-trifluorocyclohexa-1,3-dien-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 143987869 |
| Molecular Formula | C9H11F3O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2-(3,4,5-trifluorocyclohexa-1,3-dien-1-yl)propan-1-ol |
| SMILES | CC(CO)C1=CC(F)=C(F)C(F)C1 |
| InChI | InChI=1S/C9H11F3O/c1-5(4-13)6-2-7(10)9(12)8(11)3-6/h2,5,8,13H,3-4H2,1H3 |
| InChIKey | JPVSFSUTBLDIPA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |