C25H23F3N4O4 — CID 143987921
[(8E)-8-[[3-methoxy-4-(5-methyl-4H-pyrimidin-1-yl)phenyl]methylidene]-3-(3,4,5-trifluorophenyl)-5,6-dihydro-[1,2,4]oxadiazolo[3,4-c][1,4]oxazin-3-yl]methanol (PubChem CID 143987921) has the molecular formula C25H23F3N4O4 and a molecular weight of 500.48 g/mol. Its IUPAC name is [(8E)-8-[[3-methoxy-4-(5-methyl-4H-pyrimidin-1-yl)phenyl]methylidene]-3-(3,4,5-trifluorophenyl)-5,6-dihydro-[1,2,4]oxadiazolo[3,4-c][1,4]oxazin-3-yl]methanol.
| Compound Name | [(8E)-8-[[3-methoxy-4-(5-methyl-4H-pyrimidin-1-yl)phenyl]methylidene]-3-(3,4,5-trifluorophenyl)-5,6-dihydro-[1,2,4]oxadiazolo[3,4-c][1,4]oxazin-3-yl]methanol |
|---|---|
| PubChem CID | 143987921 |
| Molecular Formula | C25H23F3N4O4 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | [(8E)-8-[[3-methoxy-4-(5-methyl-4H-pyrimidin-1-yl)phenyl]methylidene]-3-(3,4,5-trifluorophenyl)-5,6-dihydro-[1,2,4]oxadiazolo[3,4-c][1,4]oxazin-3-yl]methanol |
| SMILES | COc1cc(/C=C2/OCCN3C2=NOC3(CO)c2cc(F)c(F)c(F)c2)ccc1N1C=NCC(C)=C1 |
| InChI | InChI=1S/C25H23F3N4O4/c1-15-11-29-14-31(12-15)20-4-3-16(7-21(20)34-2)8-22-24-30-36-25(13-33,32(24)5-6-35-22)17-9-18(26)23(28)19(27)10-17/h3-4,7-10,12,14,33H,5-6,11,13H2,1-2H3/b22-8+ |
| InChIKey | OUFQCYAENFJKAK-GZIVZEMBSA-N |
| XLogP | 3.73 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|