C28H36F3N7O3S — CID 143988467
2-amino-N',N'-bis(2-aminoethyl)-N-[1-sulfanyl-1-[4-(trifluoromethyl)phenyl]propan-2-yl]butanediamide;N-quinolin-6-ylformamide (PubChem CID 143988467) has the molecular formula C28H36F3N7O3S and a molecular weight of 607.70 g/mol. Its IUPAC name is 2-amino-N',N'-bis(2-aminoethyl)-N-[1-sulfanyl-1-[4-(trifluoromethyl)phenyl]propan-2-yl]butanediamide;N-quinolin-6-ylformamide.
| Compound Name | 2-amino-N',N'-bis(2-aminoethyl)-N-[1-sulfanyl-1-[4-(trifluoromethyl)phenyl]propan-2-yl]butanediamide;N-quinolin-6-ylformamide |
|---|---|
| PubChem CID | 143988467 |
| Molecular Formula | C28H36F3N7O3S |
| Molecular Weight | 607.70 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | 2-amino-N',N'-bis(2-aminoethyl)-N-[1-sulfanyl-1-[4-(trifluoromethyl)phenyl]propan-2-yl]butanediamide;N-quinolin-6-ylformamide |
| SMILES | CC(NC(=O)C(N)CC(=O)N(CCN)CCN)C(S)c1ccc(C(F)(F)F)cc1.O=CNc1ccc2ncccc2c1 |
| InChI | InChI=1S/C18H28F3N5O2S.C10H8N2O/c1-11(16(29)12-2-4-13(5-3-12)18(19,20)21)25-17(28)14(24)10-15(27)26(8-6-22)9-7-23;13-7-12-9-3-4-10-8(6-9)2-1-5-11-10/h2-5,11,14,16,29H,6-10,22-24H2,1H3,(H,25,28);1-7H,(H,12,13) |
| InChIKey | OKTXBCAPRDSVEU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 169.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.70 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|