C29H31F3N6O4 — CID 161170331
(4S)-4-amino-N,N-bis(2-aminoethyl)-2-oxo-N'-[(E)-3-oxo-4-quinolin-3-yl-1-[4-(trifluoromethyl)phenyl]but-1-en-2-yl]pentanediamide (PubChem CID 161170331) has the molecular formula C29H31F3N6O4 and a molecular weight of 584.60 g/mol. Its IUPAC name is (4S)-4-amino-N,N-bis(2-aminoethyl)-2-oxo-N'-[(E)-3-oxo-4-quinolin-3-yl-1-[4-(trifluoromethyl)phenyl]but-1-en-2-yl]pentanediamide.
| Compound Name | (4S)-4-amino-N,N-bis(2-aminoethyl)-2-oxo-N'-[(E)-3-oxo-4-quinolin-3-yl-1-[4-(trifluoromethyl)phenyl]but-1-en-2-yl]pentanediamide |
|---|---|
| PubChem CID | 161170331 |
| Molecular Formula | C29H31F3N6O4 |
| Molecular Weight | 584.60 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | (4S)-4-amino-N,N-bis(2-aminoethyl)-2-oxo-N'-[(E)-3-oxo-4-quinolin-3-yl-1-[4-(trifluoromethyl)phenyl]but-1-en-2-yl]pentanediamide |
| SMILES | NCCN(CCN)C(=O)C(=O)C[C@H](N)C(=O)N/C(=C/c1ccc(C(F)(F)F)cc1)C(=O)Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C29H31F3N6O4/c30-29(31,32)21-7-5-18(6-8-21)14-24(25(39)15-19-13-20-3-1-2-4-23(20)36-17-19)37-27(41)22(35)16-26(40)28(42)38(11-9-33)12-10-34/h1-8,13-14,17,22H,9-12,15-16,33-35H2,(H,37,41)/b24-14+/t22-/m0/s1 |
| InChIKey | MVOXJPGDLCTOMD-YQNSVDCASA-N |
| XLogP | 1.55 |
| TPSA | 174.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.60 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|