C12H17NO2 — CID 143988674
ethane;1-(4-hydroxyphenyl)cyclopropane-1-carboxamide (PubChem CID 143988674) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is ethane;1-(4-hydroxyphenyl)cyclopropane-1-carboxamide.
| Compound Name | ethane;1-(4-hydroxyphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 143988674 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | ethane;1-(4-hydroxyphenyl)cyclopropane-1-carboxamide |
| SMILES | CC.NC(=O)C1(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C10H11NO2.C2H6/c11-9(13)10(5-6-10)7-1-3-8(12)4-2-7;1-2/h1-4,12H,5-6H2,(H2,11,13);1-2H3 |
| InChIKey | PVESEDHLGRLLJR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |