C10H10F5NOS — CID 156893243
1-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 156893243) has the molecular formula C10H10F5NOS and a molecular weight of 287.25 g/mol. Its IUPAC name is 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 156893243 |
| Molecular Formula | C10H10F5NOS |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 1-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | NC(=O)C1(c2ccc(S(F)(F)(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C10H10F5NOS/c11-18(12,13,14,15)8-3-1-7(2-4-8)10(5-6-10)9(16)17/h1-4H,5-6H2,(H2,16,17) |
| InChIKey | OZLAUMXFGCQISJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |